C16H13F3O — CID 163602291
1-ethenyl-4-[[4-(trifluoromethyl)phenoxy]methyl]benzene (PubChem CID 163602291) has the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-ethenyl-4-[[4-(trifluoromethyl)phenoxy]methyl]benzene.
| Compound Name | 1-ethenyl-4-[[4-(trifluoromethyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 163602291 |
| Molecular Formula | C16H13F3O |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-ethenyl-4-[[4-(trifluoromethyl)phenoxy]methyl]benzene |
| SMILES | C=Cc1ccc(COc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F3O/c1-2-12-3-5-13(6-4-12)11-20-15-9-7-14(8-10-15)16(17,18)19/h2-10H,1,11H2 |
| InChIKey | GYRRHYSHPPOWSD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |