About 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine
1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine (PubChem CID 145260573) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine.
Molecular Properties
| Compound Name | 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine |
| PubChem CID | 145260573 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine |
| SMILES | C=Cc1ccc(COc2ccc(C)cc2)cc1.C=NC |
| InChI | InChI=1S/C16H16O.C2H5N/c1-3-14-6-8-15(9-7-14)12-17-16-10-4-13(2)5-11-16;1-3-2/h3-11H,1,12H2,2H3;1H2,2H3 |
| InChIKey | HNNDOURKJFSKBN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine?
The IUPAC name of 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine (CID 145260573) is 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine.
What is the SMILES notation for 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine?
The canonical SMILES for 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine is C=Cc1ccc(COc2ccc(C)cc2)cc1.C=NC.
What is the InChIKey of 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine?
The InChIKey is HNNDOURKJFSKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O.C2H5N/c1-3-14-6-8-15(9-7-14)12-17-16-10-4-13(2)5-11-16;1-3-2/h3-11H,1,12H2,2H3;1H2,2H3.
What are the key properties of 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine?
1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine has a molecular weight of 267.37 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-[(4-methylphenoxy)methyl]benzene;N-methylmethanimine is sourced from PubChem (CID 145260573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).