C21H29NO — CID 145260574
N-butyl-1-[4-[(4-methylphenyl)methoxy]phenyl]methanimine;ethane (PubChem CID 145260574) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-butyl-1-[4-[(4-methylphenyl)methoxy]phenyl]methanimine;ethane.
| Compound Name | N-butyl-1-[4-[(4-methylphenyl)methoxy]phenyl]methanimine;ethane |
|---|---|
| PubChem CID | 145260574 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-butyl-1-[4-[(4-methylphenyl)methoxy]phenyl]methanimine;ethane |
| SMILES | CC.CCCC/N=C/c1ccc(OCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H23NO.C2H6/c1-3-4-13-20-14-17-9-11-19(12-10-17)21-15-18-7-5-16(2)6-8-18;1-2/h5-12,14H,3-4,13,15H2,1-2H3;1-2H3/b20-14+; |
| InChIKey | LSFTWEGBHFMLHO-RANVTSCRSA-N |
| XLogP | 5.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|