C21H24F3NO2 — CID 23343830
N-hexyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine (PubChem CID 23343830) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-hexyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine.
| Compound Name | N-hexyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 23343830 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-hexyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
| SMILES | CCCCCC/N=C/c1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H24F3NO2/c1-2-3-4-5-14-25-15-17-6-10-19(11-7-17)26-16-18-8-12-20(13-9-18)27-21(22,23)24/h6-13,15H,2-5,14,16H2,1H3/b25-15+ |
| InChIKey | JFXNCVSYEGXUKW-MFKUBSTISA-N |
| XLogP | 6.16 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|