C19H20F3NO2 — CID 23343809
N-butan-2-yl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine (PubChem CID 23343809) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-butan-2-yl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine.
| Compound Name | N-butan-2-yl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 23343809 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-butan-2-yl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
| SMILES | CCC(C)/N=C/c1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F3NO2/c1-3-14(2)23-12-15-4-8-17(9-5-15)24-13-16-6-10-18(11-7-16)25-19(20,21)22/h4-12,14H,3,13H2,1-2H3/b23-12+ |
| InChIKey | ZORZJZKTNFVCBO-FSJBWODESA-N |
| XLogP | 5.38 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|