C17H14F5NO2 — CID 155686082
N-(2,2-difluoropropyl)-1-[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanimine (PubChem CID 155686082) has the molecular formula C17H14F5NO2 and a molecular weight of 359.29 g/mol. Its IUPAC name is N-(2,2-difluoropropyl)-1-[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanimine.
| Compound Name | N-(2,2-difluoropropyl)-1-[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 155686082 |
| Molecular Formula | C17H14F5NO2 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(2,2-difluoropropyl)-1-[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanimine |
| SMILES | CC(F)(F)C/N=C/c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F5NO2/c1-16(18,19)11-23-10-12-2-4-13(5-3-12)24-14-6-8-15(9-7-14)25-17(20,21)22/h2-10H,11H2,1H3/b23-10+ |
| InChIKey | IPZJFVCYIFTQEK-AUEPDCJTSA-N |
| XLogP | 5.45 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|