About N-methylethanamine;4-(trifluoromethoxy)benzaldehyde
N-methylethanamine;4-(trifluoromethoxy)benzaldehyde (PubChem CID 171100197) has the molecular formula C11H14F3NO2
and a molecular weight of 249.23 g/mol. Its IUPAC name is N-methylethanamine;4-(trifluoromethoxy)benzaldehyde.
Molecular Properties
| Compound Name | N-methylethanamine;4-(trifluoromethoxy)benzaldehyde |
| PubChem CID | 171100197 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-methylethanamine;4-(trifluoromethoxy)benzaldehyde |
| SMILES | CCNC.O=Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5F3O2.C3H9N/c9-8(10,11)13-7-3-1-6(5-12)2-4-7;1-3-4-2/h1-5H;4H,3H2,1-2H3 |
| InChIKey | NSJPVRWXTZAMTJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-methylethanamine;4-(trifluoromethoxy)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanamine;4-(trifluoromethoxy)benzaldehyde?
The IUPAC name of N-methylethanamine;4-(trifluoromethoxy)benzaldehyde (CID 171100197) is N-methylethanamine;4-(trifluoromethoxy)benzaldehyde.
What is the SMILES notation for N-methylethanamine;4-(trifluoromethoxy)benzaldehyde?
The canonical SMILES for N-methylethanamine;4-(trifluoromethoxy)benzaldehyde is CCNC.O=Cc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of N-methylethanamine;4-(trifluoromethoxy)benzaldehyde?
The InChIKey is NSJPVRWXTZAMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O2.C3H9N/c9-8(10,11)13-7-3-1-6(5-12)2-4-7;1-3-4-2/h1-5H;4H,3H2,1-2H3.
What are the key properties of N-methylethanamine;4-(trifluoromethoxy)benzaldehyde?
N-methylethanamine;4-(trifluoromethoxy)benzaldehyde has a molecular weight of 249.23 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanamine;4-(trifluoromethoxy)benzaldehyde is sourced from PubChem (CID 171100197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).