C10H6F6O3 — CID 122360982
4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde (PubChem CID 122360982) has the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde.
| Compound Name | 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 122360982 |
| Molecular Formula | C10H6F6O3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)(F)C(F)OC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H6F6O3/c11-8(19-10(14,15)16)9(12,13)18-7-3-1-6(5-17)2-4-7/h1-5,8H |
| InChIKey | UAOCUMSQLIEWLJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|