C9H7F6NO2 — CID 15671378
4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]aniline (PubChem CID 15671378) has the molecular formula C9H7F6NO2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]aniline.
| Compound Name | 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 15671378 |
| Molecular Formula | C9H7F6NO2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]aniline |
| SMILES | Nc1ccc(OC(F)(F)C(F)OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F6NO2/c10-7(18-9(13,14)15)8(11,12)17-6-3-1-5(16)2-4-6/h1-4,7H,16H2 |
| InChIKey | WTRMWFQAGCMZEM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|