C10H6Cl2F6N2O3 — CID 150748942
1,1-dichloro-3-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea (PubChem CID 150748942) has the molecular formula C10H6Cl2F6N2O3 and a molecular weight of 387.06 g/mol. Its IUPAC name is 1,1-dichloro-3-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea.
| Compound Name | 1,1-dichloro-3-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 150748942 |
| Molecular Formula | C10H6Cl2F6N2O3 |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | 1,1-dichloro-3-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)C(F)OC(F)(F)F)cc1)N(Cl)Cl |
| InChI | InChI=1S/C10H6Cl2F6N2O3/c11-20(12)8(21)19-5-1-3-6(4-2-5)22-9(14,15)7(13)23-10(16,17)18/h1-4,7H,(H,19,21) |
| InChIKey | JVLHGPWBHYKITM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|