C11H7BrF6O3 — CID 122360984
2-bromo-1-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone (PubChem CID 122360984) has the molecular formula C11H7BrF6O3 and a molecular weight of 381.07 g/mol. Its IUPAC name is 2-bromo-1-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone.
| Compound Name | 2-bromo-1-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 122360984 |
| Molecular Formula | C11H7BrF6O3 |
| Molecular Weight | 381.07 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 2-bromo-1-[4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone |
| SMILES | O=C(CBr)c1ccc(OC(F)(F)C(F)OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7BrF6O3/c12-5-8(19)6-1-3-7(4-2-6)20-10(14,15)9(13)21-11(16,17)18/h1-4,9H,5H2 |
| InChIKey | HLLOESJGNGIHCD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.07 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|