About 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene
1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene (PubChem CID 57288381) has the molecular formula C9H5ClF6O2
and a molecular weight of 294.58 g/mol. Its IUPAC name is 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene |
| PubChem CID | 57288381 |
| Molecular Formula | C9H5ClF6O2 |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene |
| SMILES | FC(OC(F)(F)F)C(F)(F)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H5ClF6O2/c10-5-1-3-6(4-2-5)17-8(12,13)7(11)18-9(14,15)16/h1-4,7H |
| InChIKey | WODCDYQWIBICPA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene?
The IUPAC name of 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene (CID 57288381) is 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene.
What is the SMILES notation for 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene?
The canonical SMILES for 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene is FC(OC(F)(F)F)C(F)(F)Oc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene?
The InChIKey is WODCDYQWIBICPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClF6O2/c10-5-1-3-6(4-2-5)17-8(12,13)7(11)18-9(14,15)16/h1-4,7H.
What are the key properties of 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene?
1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene has a molecular weight of 294.58 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzene is sourced from PubChem (CID 57288381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).