C10H6F9NO2 — CID 14823054
2-fluoro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]aniline (PubChem CID 14823054) has the molecular formula C10H6F9NO2 and a molecular weight of 343.15 g/mol. Its IUPAC name is 2-fluoro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]aniline.
| Compound Name | 2-fluoro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 14823054 |
| Molecular Formula | C10H6F9NO2 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-fluoro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]aniline |
| SMILES | Nc1ccc(OC(F)(F)C(F)OC(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H6F9NO2/c11-5-3-4(1-2-6(5)20)21-8(13,14)7(12)22-10(18,19)9(15,16)17/h1-3,7H,20H2 |
| InChIKey | VRRXKSGPHVWLQX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|