C8H6Cl2F3NO — CID 44717352
2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)aniline (PubChem CID 44717352) has the molecular formula C8H6Cl2F3NO and a molecular weight of 260.04 g/mol. Its IUPAC name is 2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)aniline.
| Compound Name | 2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 44717352 |
| Molecular Formula | C8H6Cl2F3NO |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)aniline |
| SMILES | Nc1cc(OC(F)(F)C(F)Cl)ccc1Cl |
| InChI | InChI=1S/C8H6Cl2F3NO/c9-5-2-1-4(3-6(5)14)15-8(12,13)7(10)11/h1-3,7H,14H2 |
| InChIKey | IPNPCUVVUHAXQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|