C11H5Cl3F6O3 — CID 20530643
2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzoyl chloride (PubChem CID 20530643) has the molecular formula C11H5Cl3F6O3 and a molecular weight of 405.51 g/mol. Its IUPAC name is 2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzoyl chloride.
| Compound Name | 2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzoyl chloride |
|---|---|
| PubChem CID | 20530643 |
| Molecular Formula | C11H5Cl3F6O3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(OC(F)(F)C(F)Cl)cc1OC(F)(F)C(F)Cl |
| InChI | InChI=1S/C11H5Cl3F6O3/c12-7(21)5-2-1-4(22-10(17,18)8(13)15)3-6(5)23-11(19,20)9(14)16/h1-3,8-9H |
| InChIKey | QTTNZSCOKJOKOM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|