C8H6ClF3O2 — CID 26596565
4-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenol (PubChem CID 26596565) has the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. Its IUPAC name is 4-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenol.
| Compound Name | 4-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenol |
|---|---|
| PubChem CID | 26596565 |
| Molecular Formula | C8H6ClF3O2 |
| Molecular Weight | 226.58 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 4-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenol |
| SMILES | Oc1ccc(OC(F)(F)[C@H](F)Cl)cc1 |
| InChI | InChI=1S/C8H6ClF3O2/c9-7(10)8(11,12)14-6-3-1-5(13)2-4-6/h1-4,7,13H/t7-/m0/s1 |
| InChIKey | IHSZEBVZILGPJR-ZETCQYMHSA-N |
| XLogP | 2.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|