C15H13Cl2F3O2 — CID 54401339
2-[2-(1-chlorocyclopropyl)-2-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]ethenyl]oxirane (PubChem CID 54401339) has the molecular formula C15H13Cl2F3O2 and a molecular weight of 353.17 g/mol. Its IUPAC name is 2-[2-(1-chlorocyclopropyl)-2-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]ethenyl]oxirane.
| Compound Name | 2-[2-(1-chlorocyclopropyl)-2-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]ethenyl]oxirane |
|---|---|
| PubChem CID | 54401339 |
| Molecular Formula | C15H13Cl2F3O2 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-[2-(1-chlorocyclopropyl)-2-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]ethenyl]oxirane |
| SMILES | FC(Cl)C(F)(F)Oc1ccc(C(=CC2CO2)C2(Cl)CC2)cc1 |
| InChI | InChI=1S/C15H13Cl2F3O2/c16-13(18)15(19,20)22-10-3-1-9(2-4-10)12(7-11-8-21-11)14(17)5-6-14/h1-4,7,11,13H,5-6,8H2 |
| InChIKey | VNQMVQRYIWSQPU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|