C12H13F4NO — CID 171208678
(R)-cyclopropyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine (PubChem CID 171208678) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is (R)-cyclopropyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine.
| Compound Name | (R)-cyclopropyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171208678 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (R)-cyclopropyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine |
| SMILES | N[C@@H](c1ccc(OC(F)(F)C(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C12H13F4NO/c13-11(14)12(15,16)18-9-5-3-8(4-6-9)10(17)7-1-2-7/h3-7,10-11H,1-2,17H2/t10-/m1/s1 |
| InChIKey | ULVHJCSWFONKKT-SNVBAGLBSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|