C16H10F6O3 — CID 56628976
4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoic acid (PubChem CID 56628976) has the molecular formula C16H10F6O3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoic acid.
| Compound Name | 4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 56628976 |
| Molecular Formula | C16H10F6O3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(OC(F)(F)C(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H10F6O3/c17-14(15(18,19)20)16(21,22)25-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(23)24/h1-8,14H,(H,23,24) |
| InChIKey | JOMVKWLJKJTUOG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |