C15H10F6N2O2 — CID 21203387
N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]pyridine-3-carboxamide (PubChem CID 21203387) has the molecular formula C15H10F6N2O2 and a molecular weight of 364.25 g/mol. Its IUPAC name is N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21203387 |
| Molecular Formula | C15H10F6N2O2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C15H10F6N2O2/c16-13(14(17,18)19)15(20,21)25-11-5-3-10(4-6-11)23-12(24)9-2-1-7-22-8-9/h1-8,13H,(H,23,24) |
| InChIKey | PEHDTYVUUMMAEO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |