C16H16N2O3 — CID 75539634
2-methyl-2-[4-(pyridine-3-carbonylamino)phenyl]propanoic acid (PubChem CID 75539634) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-methyl-2-[4-(pyridine-3-carbonylamino)phenyl]propanoic acid.
| Compound Name | 2-methyl-2-[4-(pyridine-3-carbonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 75539634 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-methyl-2-[4-(pyridine-3-carbonylamino)phenyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-16(2,15(20)21)12-5-7-13(8-6-12)18-14(19)11-4-3-9-17-10-11/h3-10H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VXGUDZUYKWCXQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |