C14H10ClF3N2O2 — CID 21203373
N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 21203373) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21203373 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)C(F)Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C14H10ClF3N2O2/c15-13(16)14(17,18)22-11-5-3-10(4-6-11)20-12(21)9-2-1-7-19-8-9/h1-8,13H,(H,20,21) |
| InChIKey | UIKWEJONDWVKNX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|