C17H12F6N2O3 — CID 160756565
N-carbamoyl-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzamide (PubChem CID 160756565) has the molecular formula C17H12F6N2O3 and a molecular weight of 406.28 g/mol. Its IUPAC name is N-carbamoyl-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzamide.
| Compound Name | N-carbamoyl-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 160756565 |
| Molecular Formula | C17H12F6N2O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-carbamoyl-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzamide |
| SMILES | NC(=O)N(C(=O)c1ccccc1)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F6N2O3/c18-14(16(19,20)21)17(22,23)28-12-8-6-11(7-9-12)25(15(24)27)13(26)10-4-2-1-3-5-10/h1-9,14H,(H2,24,27) |
| InChIKey | RXMXZHWYGWPKFW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |