C11H12F6N2O — CID 170894654
1-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethane-1,2-diamine (PubChem CID 170894654) has the molecular formula C11H12F6N2O and a molecular weight of 302.22 g/mol. Its IUPAC name is 1-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethane-1,2-diamine.
| Compound Name | 1-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894654 |
| Molecular Formula | C11H12F6N2O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F6N2O/c12-9(10(13,14)15)11(16,17)20-7-3-1-6(2-4-7)8(19)5-18/h1-4,8-9H,5,18-19H2 |
| InChIKey | AIMPCCQDUZRAFJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |