C13H6F12O4 — CID 162396628
2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (PubChem CID 162396628) has the molecular formula C13H6F12O4 and a molecular weight of 454.16 g/mol. Its IUPAC name is 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.
| Compound Name | 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 162396628 |
| Molecular Formula | C13H6F12O4 |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C13H6F12O4/c14-8(10(16,17)18)12(22,23)28-4-1-2-5(7(26)27)6(3-4)29-13(24,25)9(15)11(19,20)21/h1-3,8-9H,(H,26,27) |
| InChIKey | ZIHRLPWPVLLQDV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |