2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid

C13H6F12O4 — CID 162396628

IUPAC2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
SMILESO=C(O)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1OC(F)(F)C(F)C(F)(F)F
InChIInChI=1S/C13H6F12O4/c14-8(10(16,17)18)12(22,23)28-4-1-2-5(7(26)27)6(3-4)29-13(24,25)9(15)11(19,20)21/h1-3,8-9H,(H,26,27)
InChIKeyZIHRLPWPVLLQDV-UHFFFAOYSA-N
MW454.16 g/mol
LogP5.13
Rot. Bonds7

About 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid

2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (PubChem CID 162396628) has the molecular formula C13H6F12O4 and a molecular weight of 454.16 g/mol. Its IUPAC name is 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.

Molecular Properties

Compound Name2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
PubChem CID162396628
Molecular FormulaC13H6F12O4
Molecular Weight454.16 g/mol
Exact Mass454.01
IUPAC Name2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
SMILESO=C(O)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1OC(F)(F)C(F)C(F)(F)F
InChIInChI=1S/C13H6F12O4/c14-8(10(16,17)18)12(22,23)28-4-1-2-5(7(26)27)6(3-4)29-13(24,25)9(15)11(19,20)21/h1-3,8-9H,(H,26,27)
InChIKeyZIHRLPWPVLLQDV-UHFFFAOYSA-N
XLogP5.13
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500454.16
LogP ≤ 55.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The IUPAC name of 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (CID 162396628) is 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.
What is the SMILES notation for 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The canonical SMILES for 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid is O=C(O)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1OC(F)(F)C(F)C(F)(F)F.
What is the InChIKey of 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The InChIKey is ZIHRLPWPVLLQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F12O4/c14-8(10(16,17)18)12(22,23)28-4-1-2-5(7(26)27)6(3-4)29-13(24,25)9(15)11(19,20)21/h1-3,8-9H,(H,26,27).
What are the key properties of 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid has a molecular weight of 454.16 g/mol, XLogP of 5.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid is sourced from PubChem (CID 162396628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).