C10H8F6O — CID 152766839
1-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbenzene (PubChem CID 152766839) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbenzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbenzene |
|---|---|
| PubChem CID | 152766839 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbenzene |
| SMILES | Cc1cccc(OC(F)(F)C(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6O/c1-6-3-2-4-7(5-6)17-10(15,16)8(11)9(12,13)14/h2-5,8H,1H3 |
| InChIKey | UOJIFNFIUAILOJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |