C22H19F4NO2 — CID 141062726
3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline (PubChem CID 141062726) has the molecular formula C22H19F4NO2 and a molecular weight of 405.39 g/mol. Its IUPAC name is 3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline.
| Compound Name | 3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 141062726 |
| Molecular Formula | C22H19F4NO2 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-(3-methylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
| SMILES | Cc1cccc(Oc2cccc(NCc3cccc(OC(F)(F)C(F)F)c3)c2)c1 |
| InChI | InChI=1S/C22H19F4NO2/c1-15-5-2-8-18(11-15)28-19-9-4-7-17(13-19)27-14-16-6-3-10-20(12-16)29-22(25,26)21(23)24/h2-13,21,27H,14H2,1H3 |
| InChIKey | LOUFTLWQGUXTSG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|