C23H16F9NO2 — CID 141062764
N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]aniline (PubChem CID 141062764) has the molecular formula C23H16F9NO2 and a molecular weight of 509.37 g/mol. Its IUPAC name is N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]aniline.
| Compound Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]aniline |
|---|---|
| PubChem CID | 141062764 |
| Molecular Formula | C23H16F9NO2 |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]aniline |
| SMILES | FC(F)C(F)(F)Oc1cccc(Oc2cccc(NCc3cccc(C(F)(F)C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C23H16F9NO2/c24-20(25)22(28,29)35-19-9-3-8-18(12-19)34-17-7-2-6-16(11-17)33-13-14-4-1-5-15(10-14)21(26,27)23(30,31)32/h1-12,20,33H,13H2 |
| InChIKey | ITIJWANRCUZUNR-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|