C21H15F7N2O2 — CID 141062795
3-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline (PubChem CID 141062795) has the molecular formula C21H15F7N2O2 and a molecular weight of 460.35 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline.
| Compound Name | 3-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 141062795 |
| Molecular Formula | C21H15F7N2O2 |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
| SMILES | FC(F)Oc1cc(Oc2cccc(NCc3cccc(C(F)(F)C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C21H15F7N2O2/c22-19(23)32-18-11-17(7-8-29-18)31-16-6-2-5-15(10-16)30-12-13-3-1-4-14(9-13)20(24,25)21(26,27)28/h1-11,19,30H,12H2 |
| InChIKey | GSYUEUQRFKRPMY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|