C21H14BrF6NO — CID 141060031
3-(5-bromo-2-fluorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline (PubChem CID 141060031) has the molecular formula C21H14BrF6NO and a molecular weight of 490.24 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline.
| Compound Name | 3-(5-bromo-2-fluorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 141060031 |
| Molecular Formula | C21H14BrF6NO |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 3-(5-bromo-2-fluorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
| SMILES | Fc1ccc(Br)cc1Oc1cccc(NCc2cccc(C(F)(F)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H14BrF6NO/c22-15-7-8-18(23)19(10-15)30-17-6-2-5-16(11-17)29-12-13-3-1-4-14(9-13)20(24,25)21(26,27)28/h1-11,29H,12H2 |
| InChIKey | YFVPLRJJVJVFQF-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|