C22H14Cl2F7NO — CID 141060105
3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]aniline (PubChem CID 141060105) has the molecular formula C22H14Cl2F7NO and a molecular weight of 512.25 g/mol. Its IUPAC name is 3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]aniline.
| Compound Name | 3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 141060105 |
| Molecular Formula | C22H14Cl2F7NO |
| Molecular Weight | 512.25 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]aniline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1cccc(CNc2cccc(Oc3cccc(Cl)c3Cl)c2)c1 |
| InChI | InChI=1S/C22H14Cl2F7NO/c23-17-8-3-9-18(19(17)24)33-16-7-2-6-15(11-16)32-12-13-4-1-5-14(10-13)20(25,26)21(27,28)22(29,30)31/h1-11,32H,12H2 |
| InChIKey | VBAYWJRKBRAZCB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.25 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|