C24H22F5NO — CID 141062796
3-[(3,5-dimethylphenyl)methoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline (PubChem CID 141062796) has the molecular formula C24H22F5NO and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline.
| Compound Name | 3-[(3,5-dimethylphenyl)methoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 141062796 |
| Molecular Formula | C24H22F5NO |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]aniline |
| SMILES | Cc1cc(C)cc(COc2cccc(NCc3cccc(C(F)(F)C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C24H22F5NO/c1-16-9-17(2)11-19(10-16)15-31-22-8-4-7-21(13-22)30-14-18-5-3-6-20(12-18)23(25,26)24(27,28)29/h3-13,30H,14-15H2,1-2H3 |
| InChIKey | JASNQFWNOZZIQH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|