C21H16F5NO — CID 141060077
N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyaniline (PubChem CID 141060077) has the molecular formula C21H16F5NO and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyaniline.
| Compound Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyaniline |
|---|---|
| PubChem CID | 141060077 |
| Molecular Formula | C21H16F5NO |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyaniline |
| SMILES | FC(F)(F)C(F)(F)c1cccc(CNc2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H16F5NO/c22-20(23,21(24,25)26)16-7-4-6-15(12-16)14-27-17-8-5-11-19(13-17)28-18-9-2-1-3-10-18/h1-13,27H,14H2 |
| InChIKey | QFLKCRWXHJCXIQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|