C23H17F8NO2 — CID 141062749
N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]aniline (PubChem CID 141062749) has the molecular formula C23H17F8NO2 and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]aniline.
| Compound Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]aniline |
|---|---|
| PubChem CID | 141062749 |
| Molecular Formula | C23H17F8NO2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]aniline |
| SMILES | FC(F)(F)Oc1cccc(COc2cccc(NCc3cccc(C(F)(F)C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C23H17F8NO2/c24-21(25,22(26,27)28)17-6-1-4-15(10-17)13-32-18-7-3-8-19(12-18)33-14-16-5-2-9-20(11-16)34-23(29,30)31/h1-12,32H,13-14H2 |
| InChIKey | RNMAMCDRDOYDLB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|