C12H12F7NO2 — CID 11955347
(2R)-1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 11955347) has the molecular formula C12H12F7NO2 and a molecular weight of 335.22 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 11955347 |
| Molecular Formula | C12H12F7NO2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | O[C@H](CNCc1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C12H12F7NO2/c13-10(14)12(18,19)22-8-3-1-2-7(4-8)5-20-6-9(21)11(15,16)17/h1-4,9-10,20-21H,5-6H2/t9-/m1/s1 |
| InChIKey | WAUKIJJQHUNAQR-SECBINFHSA-N |
| XLogP | 2.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|