C25H20F9NO3 — CID 142665984
3-[3-[(3,5-difluorophenyl)methoxy]-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 142665984) has the molecular formula C25H20F9NO3 and a molecular weight of 553.42 g/mol. Its IUPAC name is 3-[3-[(3,5-difluorophenyl)methoxy]-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-[(3,5-difluorophenyl)methoxy]-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 142665984 |
| Molecular Formula | C25H20F9NO3 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 3-[3-[(3,5-difluorophenyl)methoxy]-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNc1cccc(OCc2cc(F)cc(F)c2)c1Cc1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H20F9NO3/c26-16-7-15(8-17(27)11-16)13-37-21-6-2-5-20(35-12-22(36)24(30,31)32)19(21)10-14-3-1-4-18(9-14)38-25(33,34)23(28)29/h1-9,11,22-23,35-36H,10,12-13H2 |
| InChIKey | QJOVKDXKBSQBEQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|