C15H11F6NO — CID 11002165
2,5-difluoro-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline (PubChem CID 11002165) has the molecular formula C15H11F6NO and a molecular weight of 335.25 g/mol. Its IUPAC name is 2,5-difluoro-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline.
| Compound Name | 2,5-difluoro-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11002165 |
| Molecular Formula | C15H11F6NO |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2,5-difluoro-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
| SMILES | Fc1ccc(F)c(NCc2cccc(OC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C15H11F6NO/c16-10-4-5-12(17)13(7-10)22-8-9-2-1-3-11(6-9)23-15(20,21)14(18)19/h1-7,14,22H,8H2 |
| InChIKey | UWBSNRJZFPPFAB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|