C14H14F2N2 — CID 115213122
N-[[4-(aminomethyl)phenyl]methyl]-2,5-difluoroaniline (PubChem CID 115213122) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-2,5-difluoroaniline.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 115213122 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-2,5-difluoroaniline |
| SMILES | NCc1ccc(CNc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C14H14F2N2/c15-12-5-6-13(16)14(7-12)18-9-11-3-1-10(8-17)2-4-11/h1-7,18H,8-9,17H2 |
| InChIKey | WQIRSKAFTSSXCH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |