C13H9ClF3N — CID 112651771
N-[(2-chloro-3-fluorophenyl)methyl]-2,5-difluoroaniline (PubChem CID 112651771) has the molecular formula C13H9ClF3N and a molecular weight of 271.67 g/mol. Its IUPAC name is N-[(2-chloro-3-fluorophenyl)methyl]-2,5-difluoroaniline.
| Compound Name | N-[(2-chloro-3-fluorophenyl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 112651771 |
| Molecular Formula | C13H9ClF3N |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-[(2-chloro-3-fluorophenyl)methyl]-2,5-difluoroaniline |
| SMILES | Fc1ccc(F)c(NCc2cccc(F)c2Cl)c1 |
| InChI | InChI=1S/C13H9ClF3N/c14-13-8(2-1-3-11(13)17)7-18-12-6-9(15)4-5-10(12)16/h1-6,18H,7H2 |
| InChIKey | NELSLZXRIKOFJE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |