C9H8F4O2 — CID 22508169
1-methoxy-3-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 22508169) has the molecular formula C9H8F4O2 and a molecular weight of 224.15 g/mol. Its IUPAC name is 1-methoxy-3-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-methoxy-3-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 22508169 |
| Molecular Formula | C9H8F4O2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-methoxy-3-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | COc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H8F4O2/c1-14-6-3-2-4-7(5-6)15-9(12,13)8(10)11/h2-5,8H,1H3 |
| InChIKey | DTBRXBGOZZAOLV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|