C8H5BF7KO — CID 166000083
potassium trifluoro-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]boranuide (PubChem CID 166000083) has the molecular formula C8H5BF7KO and a molecular weight of 300.02 g/mol. Its IUPAC name is potassium trifluoro-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 166000083 |
| Molecular Formula | C8H5BF7KO |
| Molecular Weight | 300.02 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | potassium trifluoro-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]boranuide |
| SMILES | FC(F)C(F)(F)Oc1cccc([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C8H5BF7O.K/c10-7(11)8(12,13)17-6-3-1-2-5(4-6)9(14,15)16;/h1-4,7H;/q-1;+1 |
| InChIKey | MRWAPWDIOKNBET-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.02 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|