C16H12F7NO2 — CID 171242513
(S)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171242513) has the molecular formula C16H12F7NO2 and a molecular weight of 383.26 g/mol. Its IUPAC name is (S)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171242513 |
| Molecular Formula | C16H12F7NO2 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (S)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@@H](c1ccc(OC(F)(F)F)cc1)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C16H12F7NO2/c17-14(18)15(19,20)25-12-3-1-2-10(8-12)13(24)9-4-6-11(7-5-9)26-16(21,22)23/h1-8,13-14H,24H2/t13-/m0/s1 |
| InChIKey | VHHMAKSGJAWQCH-ZDUSSCGKSA-N |
| XLogP | 4.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|