C11H9ClF9NO — CID 171312484
(1R)-2,2,3,3,3-pentafluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride (PubChem CID 171312484) has the molecular formula C11H9ClF9NO and a molecular weight of 377.63 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312484 |
| Molecular Formula | C11H9ClF9NO |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F9NO.ClH/c12-8(13)10(16,17)22-6-3-1-2-5(4-6)7(21)9(14,15)11(18,19)20;/h1-4,7-8H,21H2;1H/t7-;/m1./s1 |
| InChIKey | YMKBXNWFKGKQCC-OGFXRTJISA-N |
| XLogP | 4.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|