C10H11ClF5NO — CID 171208580
(1S)-2-fluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride (PubChem CID 171208580) has the molecular formula C10H11ClF5NO and a molecular weight of 291.65 g/mol. Its IUPAC name is (1S)-2-fluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride.
| Compound Name | (1S)-2-fluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171208580 |
| Molecular Formula | C10H11ClF5NO |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (1S)-2-fluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.N[C@H](CF)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H10F5NO.ClH/c11-5-8(16)6-2-1-3-7(4-6)17-10(14,15)9(12)13;/h1-4,8-9H,5,16H2;1H/t8-;/m1./s1 |
| InChIKey | HTIAAKAXFAOZJW-DDWIOCJRSA-N |
| XLogP | 3.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|