C12H15F4NO2 — CID 171208640
(4R)-4-amino-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-ol (PubChem CID 171208640) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is (4R)-4-amino-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-ol.
| Compound Name | (4R)-4-amino-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 171208640 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (4R)-4-amino-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-ol |
| SMILES | N[C@H](CCCO)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H15F4NO2/c13-11(14)12(15,16)19-9-4-1-3-8(7-9)10(17)5-2-6-18/h1,3-4,7,10-11,18H,2,5-6,17H2/t10-/m1/s1 |
| InChIKey | UBBVFNOZCIYKIG-SNVBAGLBSA-N |
| XLogP | 2.70 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|