C15H9F5O2 — CID 122475753
3-fluoro-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzaldehyde (PubChem CID 122475753) has the molecular formula C15H9F5O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 3-fluoro-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzaldehyde.
| Compound Name | 3-fluoro-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 122475753 |
| Molecular Formula | C15H9F5O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-fluoro-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzaldehyde |
| SMILES | O=Cc1cc(F)cc(-c2cccc(OC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C15H9F5O2/c16-12-5-9(8-21)4-11(6-12)10-2-1-3-13(7-10)22-15(19,20)14(17)18/h1-8,14H |
| InChIKey | DJVAMCRXFZFYJZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|