About methane;3-(trifluoromethoxy)benzaldehyde
methane;3-(trifluoromethoxy)benzaldehyde (PubChem CID 143923091) has the molecular formula C9H9F3O2
and a molecular weight of 206.16 g/mol. Its IUPAC name is methane;3-(trifluoromethoxy)benzaldehyde.
Molecular Properties
| Compound Name | methane;3-(trifluoromethoxy)benzaldehyde |
| PubChem CID | 143923091 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | methane;3-(trifluoromethoxy)benzaldehyde |
| SMILES | C.O=Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C8H5F3O2.CH4/c9-8(10,11)13-7-3-1-2-6(4-7)5-12;/h1-5H;1H4 |
| InChIKey | MTHZIHFVLYZMJQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(trifluoromethoxy)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(trifluoromethoxy)benzaldehyde?
The IUPAC name of methane;3-(trifluoromethoxy)benzaldehyde (CID 143923091) is methane;3-(trifluoromethoxy)benzaldehyde.
What is the SMILES notation for methane;3-(trifluoromethoxy)benzaldehyde?
The canonical SMILES for methane;3-(trifluoromethoxy)benzaldehyde is C.O=Cc1cccc(OC(F)(F)F)c1.
What is the InChIKey of methane;3-(trifluoromethoxy)benzaldehyde?
The InChIKey is MTHZIHFVLYZMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O2.CH4/c9-8(10,11)13-7-3-1-2-6(4-7)5-12;/h1-5H;1H4.
What are the key properties of methane;3-(trifluoromethoxy)benzaldehyde?
methane;3-(trifluoromethoxy)benzaldehyde has a molecular weight of 206.16 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(trifluoromethoxy)benzaldehyde is sourced from PubChem (CID 143923091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).