C9H5F5O2 — CID 141172743
3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzaldehyde (PubChem CID 141172743) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzaldehyde.
| Compound Name | 3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 141172743 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzaldehyde |
| SMILES | O=Cc1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H5F5O2/c10-6-1-5(4-15)2-7(3-6)16-9(13,14)8(11)12/h1-4,8H |
| InChIKey | CEFZEXSEVDMPLM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|