C15H12F4O2 — CID 57101918
1-methoxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzene (PubChem CID 57101918) has the molecular formula C15H12F4O2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-methoxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzene.
| Compound Name | 1-methoxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 57101918 |
| Molecular Formula | C15H12F4O2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-methoxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzene |
| SMILES | COc1ccc(-c2cccc(OC(F)(F)C(F)F)c2)cc1 |
| InChI | InChI=1S/C15H12F4O2/c1-20-12-7-5-10(6-8-12)11-3-2-4-13(9-11)21-15(18,19)14(16)17/h2-9,14H,1H3 |
| InChIKey | PPJICVUMOAKRMK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|