C15H20F4O — CID 59545774
1-heptyl-3-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 59545774) has the molecular formula C15H20F4O and a molecular weight of 292.32 g/mol. Its IUPAC name is 1-heptyl-3-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-heptyl-3-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 59545774 |
| Molecular Formula | C15H20F4O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-heptyl-3-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CCCCCCCc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C15H20F4O/c1-2-3-4-5-6-8-12-9-7-10-13(11-12)20-15(18,19)14(16)17/h7,9-11,14H,2-6,8H2,1H3 |
| InChIKey | YGXJVROJKYSWHY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|